C18H20S2 — CID 102180972
3,13-dithiatricyclo[13.5.0.05,11]icosa-1(15),5(11),6,9,16,19-hexaene (PubChem CID 102180972) has the molecular formula C18H20S2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 3,13-dithiatricyclo[13.5.0.05,11]icosa-1(15),5(11),6,9,16,19-hexaene.
| Compound Name | 3,13-dithiatricyclo[13.5.0.05,11]icosa-1(15),5(11),6,9,16,19-hexaene |
|---|---|
| PubChem CID | 102180972 |
| Molecular Formula | C18H20S2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 3,13-dithiatricyclo[13.5.0.05,11]icosa-1(15),5(11),6,9,16,19-hexaene |
| SMILES | C1=CC2=C(C=CC1)CSCC1=C(C=CCC=C1)CSC2 |
| InChI | InChI=1S/C18H20S2/c1-3-7-15-11-19-13-17-9-5-2-6-10-18(17)14-20-12-16(15)8-4-1/h3-10H,1-2,11-14H2 |
| InChIKey | UJUDRFXVUVLFIM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |