C19H4F14 — CID 102181048
1,2,4,5-tetrafluoro-3-[3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]cyclopenta-1,3-dien-1-yl]-6-(trifluoromethyl)benzene (PubChem CID 102181048) has the molecular formula C19H4F14 and a molecular weight of 498.21 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]cyclopenta-1,3-dien-1-yl]-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]cyclopenta-1,3-dien-1-yl]-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 102181048 |
| Molecular Formula | C19H4F14 |
| Molecular Weight | 498.21 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]cyclopenta-1,3-dien-1-yl]-6-(trifluoromethyl)benzene |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1C1=CCC(c2c(F)c(F)c(C(F)(F)F)c(F)c2F)=C1 |
| InChI | InChI=1S/C19H4F14/c20-10-6(11(21)15(25)8(14(10)24)18(28,29)30)4-1-2-5(3-4)7-12(22)16(26)9(19(31,32)33)17(27)13(7)23/h1,3H,2H2 |
| InChIKey | CGUKWEQPHUCVLF-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.21 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|