About [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate
[[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 10218119) has the molecular formula C15H11F6IO4S
and a molecular weight of 528.21 g/mol. Its IUPAC name is [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate |
| PubChem CID | 10218119 |
| Molecular Formula | C15H11F6IO4S |
| Molecular Weight | 528.21 g/mol |
| Exact Mass | 527.93 |
| IUPAC Name | [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OI(O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H11F6IO4S/c1-9-2-4-13(5-3-9)27(24,25)26-22(23)12-7-10(14(16,17)18)6-11(8-12)15(19,20)21/h2-8,23H,1H3 |
| InChIKey | QCPZHBMRHBOWGM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate?
The IUPAC name of [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate (CID 10218119) is [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate?
The canonical SMILES for [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OI(O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate?
The InChIKey is QCPZHBMRHBOWGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F6IO4S/c1-9-2-4-13(5-3-9)27(24,25)26-22(23)12-7-10(14(16,17)18)6-11(8-12)15(19,20)21/h2-8,23H,1H3.
What are the key properties of [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate?
[[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate has a molecular weight of 528.21 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[3,5-bis(trifluoromethyl)phenyl]-hydroxy-lambda3-iodanyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 10218119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).