C14H22OS — CID 102181542
(2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]sulfanyl]but-3-en-1-ol (PubChem CID 102181542) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is (2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]sulfanyl]but-3-en-1-ol.
| Compound Name | (2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]sulfanyl]but-3-en-1-ol |
|---|---|
| PubChem CID | 102181542 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2S)-2-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]sulfanyl]but-3-en-1-ol |
| SMILES | C=C[C@@H](CO)SC1=C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C14H22OS/c1-5-11(9-15)16-12-8-10-6-7-14(12,4)13(10,2)3/h5,8,10-11,15H,1,6-7,9H2,2-4H3/t10-,11+,14+/m1/s1 |
| InChIKey | INDIMFNXRVVKTJ-SUNKGSAMSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|