About [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate
[(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate (PubChem CID 102181639) has the molecular formula C20H18BrNO5
and a molecular weight of 432.27 g/mol. Its IUPAC name is [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate.
Molecular Properties
| Compound Name | [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate |
| PubChem CID | 102181639 |
| Molecular Formula | C20H18BrNO5 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate |
| SMILES | CC(=O)OC[C@@]1(COC(=O)c2ccc(Br)cc2)COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C20H18BrNO5/c1-14(23)25-11-20(12-26-18(22-20)15-5-3-2-4-6-15)13-27-19(24)16-7-9-17(21)10-8-16/h2-10H,11-13H2,1H3/t20-/m0/s1 |
| InChIKey | KPXXMJZWGIFWJP-FQEVSTJZSA-N |
| XLogP | 3.38 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate?
The IUPAC name of [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate (CID 102181639) is [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate.
What is the SMILES notation for [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate?
The canonical SMILES for [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate is CC(=O)OC[C@@]1(COC(=O)c2ccc(Br)cc2)COC(c2ccccc2)=N1.
What is the InChIKey of [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate?
The InChIKey is KPXXMJZWGIFWJP-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H18BrNO5/c1-14(23)25-11-20(12-26-18(22-20)15-5-3-2-4-6-15)13-27-19(24)16-7-9-17(21)10-8-16/h2-10H,11-13H2,1H3/t20-/m0/s1.
What are the key properties of [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate?
[(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate has a molecular weight of 432.27 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-4-(acetyloxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]methyl 4-bromobenzoate is sourced from PubChem (CID 102181639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).