About ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate
ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 102181640) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate |
| PubChem CID | 102181640 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CCOC(=O)CC[C@]1(CO)COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C15H19NO4/c1-2-19-13(18)8-9-15(10-17)11-20-14(16-15)12-6-4-3-5-7-12/h3-7,17H,2,8-11H2,1H3/t15-/m0/s1 |
| InChIKey | DVZUQZSNEKPQMM-HNNXBMFYSA-N |
| XLogP | 1.54 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate?
The IUPAC name of ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate (CID 102181640) is ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate.
What is the SMILES notation for ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate?
The canonical SMILES for ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate is CCOC(=O)CC[C@]1(CO)COC(c2ccccc2)=N1.
What is the InChIKey of ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate?
The InChIKey is DVZUQZSNEKPQMM-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H19NO4/c1-2-19-13(18)8-9-15(10-17)11-20-14(16-15)12-6-4-3-5-7-12/h3-7,17H,2,8-11H2,1H3/t15-/m0/s1.
What are the key properties of ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate?
ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate has a molecular weight of 277.32 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4S)-4-(hydroxymethyl)-2-phenyl-5H-1,3-oxazol-4-yl]propanoate is sourced from PubChem (CID 102181640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).