C54H68N2O6 — CID 102181942
2-cyclohexyl-5-[(E)-2-[4-[(E)-2-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]isoindole-1,3-dione (PubChem CID 102181942) has the molecular formula C54H68N2O6 and a molecular weight of 841.15 g/mol. Its IUPAC name is 2-cyclohexyl-5-[(E)-2-[4-[(E)-2-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]isoindole-1,3-dione.
| Compound Name | 2-cyclohexyl-5-[(E)-2-[4-[(E)-2-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102181942 |
| Molecular Formula | C54H68N2O6 |
| Molecular Weight | 841.15 g/mol |
| Exact Mass | 840.51 |
| IUPAC Name | 2-cyclohexyl-5-[(E)-2-[4-[(E)-2-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)ethenyl]-2,5-dioctoxyphenyl]ethenyl]isoindole-1,3-dione |
| SMILES | CCCCCCCCOc1cc(/C=C/c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)c(OCCCCCCCC)cc1/C=C/c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C54H68N2O6/c1-3-5-7-9-11-19-33-61-49-37-42(30-26-40-28-32-46-48(36-40)54(60)56(52(46)58)44-23-17-14-18-24-44)50(62-34-20-12-10-8-6-4-2)38-41(49)29-25-39-27-31-45-47(35-39)53(59)55(51(45)57)43-21-15-13-16-22-43/h25-32,35-38,43-44H,3-24,33-34H2,1-2H3/b29-25+,30-26+ |
| InChIKey | RABLTRBURWTVPH-XDHTVYJESA-N |
| XLogP | 13.36 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.15 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|