About tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate
tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate (PubChem CID 102182148) has the molecular formula C17H30O5Si
and a molecular weight of 342.51 g/mol. Its IUPAC name is tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate.
Molecular Properties
| Compound Name | tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate |
| PubChem CID | 102182148 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC[C@H]1O[C@@H]1CCCC(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H30O5Si/c1-17(2,3)22-16(19)20-12-15-14(21-15)9-7-8-13(18)10-11-23(4,5)6/h13-15,18H,7-9,12H2,1-6H3/t13?,14-,15-/m1/s1 |
| InChIKey | LYIRLWOZQUEAOF-JVIGXAJISA-N |
| XLogP | 3.12 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate?
The IUPAC name of tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate (CID 102182148) is tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate.
What is the SMILES notation for tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate?
The canonical SMILES for tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate is CC(C)(C)OC(=O)OC[C@H]1O[C@@H]1CCCC(O)C#C[Si](C)(C)C.
What is the InChIKey of tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate?
The InChIKey is LYIRLWOZQUEAOF-JVIGXAJISA-N. The full InChI is InChI=1S/C17H30O5Si/c1-17(2,3)22-16(19)20-12-15-14(21-15)9-7-8-13(18)10-11-23(4,5)6/h13-15,18H,7-9,12H2,1-6H3/t13?,14-,15-/m1/s1.
What are the key properties of tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate?
tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate has a molecular weight of 342.51 g/mol, XLogP of 3.12, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(2R,3R)-3-(4-hydroxy-6-trimethylsilylhex-5-ynyl)oxiran-2-yl]methyl carbonate is sourced from PubChem (CID 102182148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).