About ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate
ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate (PubChem CID 102182167) has the molecular formula C13H23FO4
and a molecular weight of 262.32 g/mol. Its IUPAC name is ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate |
| PubChem CID | 102182167 |
| Molecular Formula | C13H23FO4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)[C@@H]1CCOC1OCC(C)(C)C |
| InChI | InChI=1S/C13H23FO4/c1-5-16-11(15)10(14)9-6-7-17-12(9)18-8-13(2,3)4/h9-10,12H,5-8H2,1-4H3/t9-,10?,12?/m0/s1 |
| InChIKey | AAEZQKSSTUTHCX-BMQDGWLCSA-N |
| XLogP | 2.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate?
The IUPAC name of ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate (CID 102182167) is ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate.
What is the SMILES notation for ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate?
The canonical SMILES for ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate is CCOC(=O)C(F)[C@@H]1CCOC1OCC(C)(C)C.
What is the InChIKey of ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate?
The InChIKey is AAEZQKSSTUTHCX-BMQDGWLCSA-N. The full InChI is InChI=1S/C13H23FO4/c1-5-16-11(15)10(14)9-6-7-17-12(9)18-8-13(2,3)4/h9-10,12H,5-8H2,1-4H3/t9-,10?,12?/m0/s1.
What are the key properties of ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate?
ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate has a molecular weight of 262.32 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3R)-2-(2,2-dimethylpropoxy)oxolan-3-yl]-2-fluoroacetate is sourced from PubChem (CID 102182167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).