C16H10F6O4 — CID 102182615
[(1S,8S,9S,12R)-8-(2,2,2-trifluoroacetyl)oxy-12-tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraenyl] 2,2,2-trifluoroacetate (PubChem CID 102182615) has the molecular formula C16H10F6O4 and a molecular weight of 380.24 g/mol. Its IUPAC name is [(1S,8S,9S,12R)-8-(2,2,2-trifluoroacetyl)oxy-12-tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraenyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,8S,9S,12R)-8-(2,2,2-trifluoroacetyl)oxy-12-tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 102182615 |
| Molecular Formula | C16H10F6O4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | [(1S,8S,9S,12R)-8-(2,2,2-trifluoroacetyl)oxy-12-tricyclo[7.2.1.02,7]dodeca-2,4,6,10-tetraenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@H]1[C@@H]2C=C[C@H]1c1ccccc1[C@H]2OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H10F6O4/c17-15(18,19)13(23)25-11-8-4-2-1-3-7(8)9-5-6-10(11)12(9)26-14(24)16(20,21)22/h1-6,9-12H/t9-,10+,11+,12+/m0/s1 |
| InChIKey | GLRROCHXMRQETE-IRCOFANPSA-N |
| XLogP | 3.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|