C16H12F6O4 — CID 102182618
[(9R,12S)-12-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] 2,2,2-trifluoroacetate (PubChem CID 102182618) has the molecular formula C16H12F6O4 and a molecular weight of 382.26 g/mol. Its IUPAC name is [(9R,12S)-12-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] 2,2,2-trifluoroacetate.
| Compound Name | [(9R,12S)-12-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 102182618 |
| Molecular Formula | C16H12F6O4 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | [(9R,12S)-12-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.2.02,7]dodeca-2,4,6-trienyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@H]1CC2C[C@@H](OC(=O)C(F)(F)F)C1c1ccccc12)C(F)(F)F |
| InChI | InChI=1S/C16H12F6O4/c17-15(18,19)13(23)25-10-5-7-6-11(26-14(24)16(20,21)22)12(10)9-4-2-1-3-8(7)9/h1-4,7,10-12H,5-6H2/t7?,10-,11+,12? |
| InChIKey | SRNOBMHNTNMJDP-ZWIXXBCXSA-N |
| XLogP | 3.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |