C22H36O3 — CID 102182624
(2R,6R,8S)-2-(furan-2-yl)-8-nonyl-1,7-dioxaspiro[5.5]undecane (PubChem CID 102182624) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2R,6R,8S)-2-(furan-2-yl)-8-nonyl-1,7-dioxaspiro[5.5]undecane.
| Compound Name | (2R,6R,8S)-2-(furan-2-yl)-8-nonyl-1,7-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 102182624 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (2R,6R,8S)-2-(furan-2-yl)-8-nonyl-1,7-dioxaspiro[5.5]undecane |
| SMILES | CCCCCCCCC[C@H]1CCC[C@@]2(CCC[C@H](c3ccco3)O2)O1 |
| InChI | InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-12-19-13-9-16-22(24-19)17-10-14-21(25-22)20-15-11-18-23-20/h11,15,18-19,21H,2-10,12-14,16-17H2,1H3/t19-,21+,22+/m0/s1 |
| InChIKey | PZDHXLOMQGXPKP-KSEOMHKRSA-N |
| XLogP | 6.93 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|