C25H42O4Si — CID 102182794
methyl (E)-5-[(1S,2S,3aS,6aR)-4-oxo-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]pent-4-enoate (PubChem CID 102182794) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is methyl (E)-5-[(1S,2S,3aS,6aR)-4-oxo-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]pent-4-enoate.
| Compound Name | methyl (E)-5-[(1S,2S,3aS,6aR)-4-oxo-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 102182794 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | methyl (E)-5-[(1S,2S,3aS,6aR)-4-oxo-1-[2-tri(propan-2-yl)silyloxyethyl]-2,3,3a,6a-tetrahydro-1H-pentalen-2-yl]pent-4-enoate |
| SMILES | COC(=O)CC/C=C/[C@@H]1C[C@@H]2C(=O)C=C[C@@H]2[C@H]1CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H42O4Si/c1-17(2)30(18(3)4,19(5)6)29-15-14-21-20(10-8-9-11-25(27)28-7)16-23-22(21)12-13-24(23)26/h8,10,12-13,17-23H,9,11,14-16H2,1-7H3/b10-8+/t20-,21+,22-,23+/m1/s1 |
| InChIKey | ICFFVISMNHCQNS-RSYTVSITSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|