C23H35NO3 — CID 102183085
[(E)-6-phenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhex-2-enyl] acetate (PubChem CID 102183085) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is [(E)-6-phenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhex-2-enyl] acetate.
| Compound Name | [(E)-6-phenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhex-2-enyl] acetate |
|---|---|
| PubChem CID | 102183085 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | [(E)-6-phenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhex-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/CCC(ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H35NO3/c1-19(25)26-18-11-7-10-15-21(20-13-8-6-9-14-20)27-24-22(2,3)16-12-17-23(24,4)5/h6-9,11,13-14,21H,10,12,15-18H2,1-5H3/b11-7+ |
| InChIKey | QZYJNDFTTNWQFF-YRNVUSSQSA-N |
| XLogP | 5.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|