C26H44O2 — CID 102183355
(1R,2S,4S)-2-[5-[(1R,2S,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-3-methylidenepentyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 102183355) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is (1R,2S,4S)-2-[5-[(1R,2S,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-3-methylidenepentyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,4S)-2-[5-[(1R,2S,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-3-methylidenepentyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 102183355 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | (1R,2S,4S)-2-[5-[(1R,2S,4S)-2-hydroxy-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-3-methylidenepentyl]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=C(CC[C@@]1(O)C(C)(C)[C@H]2CC[C@]1(C)C2)CC[C@@]1(O)C(C)(C)[C@H]2CC[C@]1(C)C2 |
| InChI | InChI=1S/C26H44O2/c1-18(8-14-25(27)21(2,3)19-10-12-23(25,6)16-19)9-15-26(28)22(4,5)20-11-13-24(26,7)17-20/h19-20,27-28H,1,8-17H2,2-7H3/t19-,20-,23+,24+,25+,26+/m0/s1 |
| InChIKey | JWWNYRHGOIWVIQ-BOTQWXNASA-N |
| XLogP | 6.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|