C30H30N8O3 — CID 10218341
5-[4-[[3-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]methyl]piperazin-1-yl]-2-(2-methoxyethoxy)benzonitrile (PubChem CID 10218341) has the molecular formula C30H30N8O3 and a molecular weight of 550.62 g/mol. Its IUPAC name is 5-[4-[[3-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]methyl]piperazin-1-yl]-2-(2-methoxyethoxy)benzonitrile.
| Compound Name | 5-[4-[[3-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]methyl]piperazin-1-yl]-2-(2-methoxyethoxy)benzonitrile |
|---|---|
| PubChem CID | 10218341 |
| Molecular Formula | C30H30N8O3 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 5-[4-[[3-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]phenyl]methyl]piperazin-1-yl]-2-(2-methoxyethoxy)benzonitrile |
| SMILES | COCCOc1ccc(N2CCN(Cc3cccc(-c4cc5nc(-c6ccco6)nn5c(N)n4)c3)CC2)cc1C#N |
| InChI | InChI=1S/C30H30N8O3/c1-39-14-15-41-26-8-7-24(17-23(26)19-31)37-11-9-36(10-12-37)20-21-4-2-5-22(16-21)25-18-28-34-29(27-6-3-13-40-27)35-38(28)30(32)33-25/h2-8,13,16-18H,9-12,14-15,20H2,1H3,(H2,32,33) |
| InChIKey | WGSXTQZQLZETNP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|