C28H40O12 — CID 102183445
(1R,14S,19R,32S)-3,6,9,12,21,24,27,30-octaoxatricyclo[30.4.0.014,19]hexatriaconta-16,34-diene-2,13,20,31-tetrone (PubChem CID 102183445) has the molecular formula C28H40O12 and a molecular weight of 568.62 g/mol. Its IUPAC name is (1R,14S,19R,32S)-3,6,9,12,21,24,27,30-octaoxatricyclo[30.4.0.014,19]hexatriaconta-16,34-diene-2,13,20,31-tetrone.
| Compound Name | (1R,14S,19R,32S)-3,6,9,12,21,24,27,30-octaoxatricyclo[30.4.0.014,19]hexatriaconta-16,34-diene-2,13,20,31-tetrone |
|---|---|
| PubChem CID | 102183445 |
| Molecular Formula | C28H40O12 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (1R,14S,19R,32S)-3,6,9,12,21,24,27,30-octaoxatricyclo[30.4.0.014,19]hexatriaconta-16,34-diene-2,13,20,31-tetrone |
| SMILES | O=C1OCCOCCOCCOC(=O)[C@@H]2CC=CC[C@@H]2C(=O)OCCOCCOCCOC(=O)[C@@H]2CC=CC[C@H]12 |
| InChI | InChI=1S/C28H40O12/c29-25-21-5-1-2-6-22(21)26(30)38-18-14-34-11-12-36-16-20-40-28(32)24-8-4-3-7-23(24)27(31)39-19-15-35-10-9-33-13-17-37-25/h1-4,21-24H,5-20H2/t21-,22+,23+,24- |
| InChIKey | VAMWYPLOUMVMEF-NVPYSNMXSA-N |
| XLogP | 1.40 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|