About methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate
methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 102183619) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 102183619 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)C(=O)C(C)=CC1=O |
| InChI | InChI=1S/C10H10O4/c1-5-4-7(11)8(10(13)14-3)6(2)9(5)12/h4H,1-3H3 |
| InChIKey | KUTBZSFBKPGOBN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (CID 102183619) is methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate is COC(=O)C1=C(C)C(=O)C(C)=CC1=O.
What is the InChIKey of methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
The InChIKey is KUTBZSFBKPGOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-5-4-7(11)8(10(13)14-3)6(2)9(5)12/h4H,1-3H3.
What are the key properties of methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate?
methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate has a molecular weight of 194.19 g/mol, XLogP of 0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethyl-3,6-dioxocyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 102183619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).