C19H25ClN2O2 — CID 102183711
[(2S,3S,3aS)-3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-piperidin-1-ylmethanone (PubChem CID 102183711) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is [(2S,3S,3aS)-3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [(2S,3S,3aS)-3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 102183711 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [(2S,3S,3aS)-3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridin-2-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@H]1ON2CCCC[C@H]2[C@@H]1c1ccc(Cl)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H25ClN2O2/c20-15-9-7-14(8-10-15)17-16-6-2-5-13-22(16)24-18(17)19(23)21-11-3-1-4-12-21/h7-10,16-18H,1-6,11-13H2/t16-,17-,18-/m0/s1 |
| InChIKey | ULMPAHSZRURMRH-BZSNNMDCSA-N |
| XLogP | 3.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |