C23H27F3N4O7S — CID 10218430
N-[(5R)-5-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]morpholine-4-carboxamide (PubChem CID 10218430) has the molecular formula C23H27F3N4O7S and a molecular weight of 560.55 g/mol. Its IUPAC name is N-[(5R)-5-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]morpholine-4-carboxamide.
| Compound Name | N-[(5R)-5-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 10218430 |
| Molecular Formula | C23H27F3N4O7S |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | N-[(5R)-5-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]-6-(hydroxyamino)-6-oxohexyl]morpholine-4-carboxamide |
| SMILES | O=C(NO)[C@@H](CCCCNC(=O)N1CCOCC1)NS(=O)(=O)c1cc(F)c(Oc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C23H27F3N4O7S/c24-15-4-6-16(7-5-15)37-21-18(25)13-17(14-19(21)26)38(34,35)29-20(22(31)28-33)3-1-2-8-27-23(32)30-9-11-36-12-10-30/h4-7,13-14,20,29,33H,1-3,8-12H2,(H,27,32)(H,28,31)/t20-/m1/s1 |
| InChIKey | PWDYHRUTNSQJTF-HXUWFJFHSA-N |
| XLogP | 2.26 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|