C36H31BF2N4 — CID 102184375
4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N,3,5-tetramethylaniline (PubChem CID 102184375) has the molecular formula C36H31BF2N4 and a molecular weight of 568.48 g/mol. Its IUPAC name is 4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N,3,5-tetramethylaniline.
| Compound Name | 4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N,3,5-tetramethylaniline |
|---|---|
| PubChem CID | 102184375 |
| Molecular Formula | C36H31BF2N4 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 4-(2,2-difluoro-4,10,12-triphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-6-yl)-N,N,3,5-tetramethylaniline |
| SMILES | Cc1cc(N(C)C)cc(C)c1-c1cc(-c2ccccc2)n2c1N=C1C(c3ccccc3)=CC(c3ccccc3)=[N+]1[B-]2(F)F |
| InChI | InChI=1S/C36H31BF2N4/c1-24-20-29(41(3)4)21-25(2)34(24)31-23-33(28-18-12-7-13-19-28)43-36(31)40-35-30(26-14-8-5-9-15-26)22-32(42(35)37(43,38)39)27-16-10-6-11-17-27/h5-23H,1-4H3 |
| InChIKey | ZWBRYYGCQUVNSW-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 23.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|