C19H18BrN3O2S — CID 102184592
ethyl 6-[1-[2-(2-bromophenyl)ethyl]imidazol-2-yl]sulfanylpyridine-3-carboxylate (PubChem CID 102184592) has the molecular formula C19H18BrN3O2S and a molecular weight of 432.34 g/mol. Its IUPAC name is ethyl 6-[1-[2-(2-bromophenyl)ethyl]imidazol-2-yl]sulfanylpyridine-3-carboxylate.
| Compound Name | ethyl 6-[1-[2-(2-bromophenyl)ethyl]imidazol-2-yl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 102184592 |
| Molecular Formula | C19H18BrN3O2S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | ethyl 6-[1-[2-(2-bromophenyl)ethyl]imidazol-2-yl]sulfanylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Sc2nccn2CCc2ccccc2Br)nc1 |
| InChI | InChI=1S/C19H18BrN3O2S/c1-2-25-18(24)15-7-8-17(22-13-15)26-19-21-10-12-23(19)11-9-14-5-3-4-6-16(14)20/h3-8,10,12-13H,2,9,11H2,1H3 |
| InChIKey | YCHVFQXFRMZYSI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |