C17H26O — CID 102185202
(3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)methanol (PubChem CID 102185202) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)methanol.
| Compound Name | (3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 102185202 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (3,5,5,6,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)methanol |
| SMILES | Cc1cc2c(cc1CO)C(C)(C)CC(C)C2(C)C |
| InChI | InChI=1S/C17H26O/c1-11-7-15-14(8-13(11)10-18)16(3,4)9-12(2)17(15,5)6/h7-8,12,18H,9-10H2,1-6H3 |
| InChIKey | GCBPXGIMZKMKQC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |