C15H18N2O2 — CID 102185685
(1R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4-diene-6,16-dione (PubChem CID 102185685) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (1R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4-diene-6,16-dione.
| Compound Name | (1R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4-diene-6,16-dione |
|---|---|
| PubChem CID | 102185685 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1R,9S,10S)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4-diene-6,16-dione |
| SMILES | O=C1[C@@H]2C[C@@H](Cn3c2cccc3=O)[C@@H]2CCCCN12 |
| InChI | InChI=1S/C15H18N2O2/c18-14-6-3-5-13-11-8-10(9-17(13)14)12-4-1-2-7-16(12)15(11)19/h3,5-6,10-12H,1-2,4,7-9H2/t10-,11+,12-/m0/s1 |
| InChIKey | IZLVMGZWFCQGDB-TUAOUCFPSA-N |
| XLogP | 1.35 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |