About ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate
ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate (PubChem CID 102186028) has the molecular formula C17H28O3Si
and a molecular weight of 308.49 g/mol. Its IUPAC name is ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate |
| PubChem CID | 102186028 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C(C(C)(C)O)C=C([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C17H28O3Si/c1-7-20-16(18)11-13-8-9-15(21(4,5)6)12-14(10-13)17(2,3)19/h10-12,19H,7-9H2,1-6H3/b13-11+ |
| InChIKey | XEJYURHWGQHBIL-ACCUITESSA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate?
The IUPAC name of ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate (CID 102186028) is ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate.
What is the SMILES notation for ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate?
The canonical SMILES for ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate is CCOC(=O)/C=C1/C=C(C(C)(C)O)C=C([Si](C)(C)C)CC1.
What is the InChIKey of ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate?
The InChIKey is XEJYURHWGQHBIL-ACCUITESSA-N. The full InChI is InChI=1S/C17H28O3Si/c1-7-20-16(18)11-13-8-9-15(21(4,5)6)12-14(10-13)17(2,3)19/h10-12,19H,7-9H2,1-6H3/b13-11+.
What are the key properties of ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate?
ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate has a molecular weight of 308.49 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-[3-(2-hydroxypropan-2-yl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate is sourced from PubChem (CID 102186028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).