C22H27NO7 — CID 102186173
9-O-tert-butyl 2-O,3-O-dimethyl (2R,3R)-5-methoxy-1,2,3,4-tetrahydrocarbazole-2,3,9-tricarboxylate (PubChem CID 102186173) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is 9-O-tert-butyl 2-O,3-O-dimethyl (2R,3R)-5-methoxy-1,2,3,4-tetrahydrocarbazole-2,3,9-tricarboxylate.
| Compound Name | 9-O-tert-butyl 2-O,3-O-dimethyl (2R,3R)-5-methoxy-1,2,3,4-tetrahydrocarbazole-2,3,9-tricarboxylate |
|---|---|
| PubChem CID | 102186173 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 9-O-tert-butyl 2-O,3-O-dimethyl (2R,3R)-5-methoxy-1,2,3,4-tetrahydrocarbazole-2,3,9-tricarboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c(n(C(=O)OC(C)(C)C)c3cccc(OC)c23)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H27NO7/c1-22(2,3)30-21(26)23-15-8-7-9-17(27-4)18(15)14-10-12(19(24)28-5)13(11-16(14)23)20(25)29-6/h7-9,12-13H,10-11H2,1-6H3/t12-,13-/m1/s1 |
| InChIKey | QXOCWFZDDJEHPN-CHWSQXEVSA-N |
| XLogP | 3.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|