C11H18O — CID 102186275
(2S,6R)-2-methyl-4-methylidene-6-(2-methylprop-2-enyl)oxane (PubChem CID 102186275) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2S,6R)-2-methyl-4-methylidene-6-(2-methylprop-2-enyl)oxane.
| Compound Name | (2S,6R)-2-methyl-4-methylidene-6-(2-methylprop-2-enyl)oxane |
|---|---|
| PubChem CID | 102186275 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2S,6R)-2-methyl-4-methylidene-6-(2-methylprop-2-enyl)oxane |
| SMILES | C=C(C)C[C@@H]1CC(=C)C[C@H](C)O1 |
| InChI | InChI=1S/C11H18O/c1-8(2)5-11-7-9(3)6-10(4)12-11/h10-11H,1,3,5-7H2,2,4H3/t10-,11+/m0/s1 |
| InChIKey | DYNCPQNAFJKTPE-WDEREUQCSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|