C26H44B2N4 — CID 102186290
1,3-ditert-butyl-2-[4-(1,3-ditert-butyl-1,3,2-diazaborol-2-yl)phenyl]-1,3,2-diazaborole (PubChem CID 102186290) has the molecular formula C26H44B2N4 and a molecular weight of 434.29 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-[4-(1,3-ditert-butyl-1,3,2-diazaborol-2-yl)phenyl]-1,3,2-diazaborole.
| Compound Name | 1,3-ditert-butyl-2-[4-(1,3-ditert-butyl-1,3,2-diazaborol-2-yl)phenyl]-1,3,2-diazaborole |
|---|---|
| PubChem CID | 102186290 |
| Molecular Formula | C26H44B2N4 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 434.38 |
| IUPAC Name | 1,3-ditert-butyl-2-[4-(1,3-ditert-butyl-1,3,2-diazaborol-2-yl)phenyl]-1,3,2-diazaborole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)B1c1ccc(B2N(C(C)(C)C)C=CN2C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H44B2N4/c1-23(2,3)29-17-18-30(24(4,5)6)27(29)21-13-15-22(16-14-21)28-31(25(7,8)9)19-20-32(28)26(10,11)12/h13-20H,1-12H3 |
| InChIKey | XSPACLDDYKACNE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|