C9H12O — CID 102186322
(3aR)-3,3a,6,8a-tetrahydro-1H-cyclohepta[c]furan (PubChem CID 102186322) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (3aR)-3,3a,6,8a-tetrahydro-1H-cyclohepta[c]furan.
| Compound Name | (3aR)-3,3a,6,8a-tetrahydro-1H-cyclohepta[c]furan |
|---|---|
| PubChem CID | 102186322 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (3aR)-3,3a,6,8a-tetrahydro-1H-cyclohepta[c]furan |
| SMILES | C1=CC2COC[C@@H]2C=CC1 |
| InChI | InChI=1S/C9H12O/c1-2-4-8-6-10-7-9(8)5-3-1/h2-5,8-9H,1,6-7H2/t8-,9?/m0/s1 |
| InChIKey | QDSRIWRPEPCTFQ-IENPIDJESA-N |
| XLogP | 1.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|