C50H70N4O4S — CID 102186510
(4-ethoxyphenyl)-[4-[10-[10-[4-[(4-ethoxyphenyl)diazenyl]-3-methylphenoxy]decylsulfanyl]decoxy]-2-methylphenyl]diazene (PubChem CID 102186510) has the molecular formula C50H70N4O4S and a molecular weight of 823.20 g/mol. Its IUPAC name is (4-ethoxyphenyl)-[4-[10-[10-[4-[(4-ethoxyphenyl)diazenyl]-3-methylphenoxy]decylsulfanyl]decoxy]-2-methylphenyl]diazene.
| Compound Name | (4-ethoxyphenyl)-[4-[10-[10-[4-[(4-ethoxyphenyl)diazenyl]-3-methylphenoxy]decylsulfanyl]decoxy]-2-methylphenyl]diazene |
|---|---|
| PubChem CID | 102186510 |
| Molecular Formula | C50H70N4O4S |
| Molecular Weight | 823.20 g/mol |
| Exact Mass | 822.51 |
| IUPAC Name | (4-ethoxyphenyl)-[4-[10-[10-[4-[(4-ethoxyphenyl)diazenyl]-3-methylphenoxy]decylsulfanyl]decoxy]-2-methylphenyl]diazene |
| SMILES | CCOc1ccc(/N=N/c2ccc(OCCCCCCCCCCSCCCCCCCCCCOc3ccc(/N=N/c4ccc(OCC)cc4)c(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C50H70N4O4S/c1-5-55-45-27-23-43(24-28-45)51-53-49-33-31-47(39-41(49)3)57-35-19-15-11-7-9-13-17-21-37-59-38-22-18-14-10-8-12-16-20-36-58-48-32-34-50(42(4)40-48)54-52-44-25-29-46(30-26-44)56-6-2/h23-34,39-40H,5-22,35-38H2,1-4H3/b53-51+,54-52+ |
| InChIKey | FZRVLXMJMBVWIB-NQOGYPPHSA-N |
| XLogP | 16.36 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.20 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|