C11H23O12S2+ — CID 102186824
[(2R,3S,4R,5R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1,2,4,5-tetrahydroxy-6-oxoniohexan-3-yl] sulfate (PubChem CID 102186824) has the molecular formula C11H23O12S2+ and a molecular weight of 411.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1,2,4,5-tetrahydroxy-6-oxoniohexan-3-yl] sulfate.
| Compound Name | [(2R,3S,4R,5R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1,2,4,5-tetrahydroxy-6-oxoniohexan-3-yl] sulfate |
|---|---|
| PubChem CID | 102186824 |
| Molecular Formula | C11H23O12S2+ |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [(2R,3S,4R,5R)-1-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1,2,4,5-tetrahydroxy-6-oxoniohexan-3-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@@H]([C@H](O)[C@H](O)C[OH2+])[C@@H](O)C(O)[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C11H22O12S2/c12-1-4(14)8(17)10(23-25(20,21)22)9(18)11(19)24-3-5(15)7(16)6(24)2-13/h4-19H,1-3H2/p+1/t4-,5-,6-,7+,8-,9-,10+,11?,24?/m1/s1 |
| InChIKey | ZJHMRFUSDVQLLZ-WRHJRDHKSA-O |
| XLogP | -6.33 |
| TPSA | 230.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|