C44H44BN — CID 102186845
4-[4-bis(2,4,6-trimethylphenyl)boranyl-3,5-dimethylphenyl]-N,N-diphenylaniline (PubChem CID 102186845) has the molecular formula C44H44BN and a molecular weight of 597.66 g/mol. Its IUPAC name is 4-[4-bis(2,4,6-trimethylphenyl)boranyl-3,5-dimethylphenyl]-N,N-diphenylaniline.
| Compound Name | 4-[4-bis(2,4,6-trimethylphenyl)boranyl-3,5-dimethylphenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102186845 |
| Molecular Formula | C44H44BN |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | 4-[4-bis(2,4,6-trimethylphenyl)boranyl-3,5-dimethylphenyl]-N,N-diphenylaniline |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2c(C)cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2C)c(C)c1 |
| InChI | InChI=1S/C44H44BN/c1-29-23-31(3)42(32(4)24-29)45(43-33(5)25-30(2)26-34(43)6)44-35(7)27-38(28-36(44)8)37-19-21-41(22-20-37)46(39-15-11-9-12-16-39)40-17-13-10-14-18-40/h9-28H,1-8H3 |
| InChIKey | TVSNKHLWOYEZFR-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|