C30H44O5 — CID 102186921
(1S,4'R,4aR,7aR)-3-[(E)-4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-4'-methoxy-3',3',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,2'-oxolane] (PubChem CID 102186921) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (1S,4'R,4aR,7aR)-3-[(E)-4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-4'-methoxy-3',3',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,2'-oxolane].
| Compound Name | (1S,4'R,4aR,7aR)-3-[(E)-4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-4'-methoxy-3',3',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,2'-oxolane] |
|---|---|
| PubChem CID | 102186921 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (1S,4'R,4aR,7aR)-3-[(E)-4-(2,5-dimethoxy-3-methylphenyl)-2-methylbut-2-enyl]-4'-methoxy-3',3',4a,7a-tetramethylspiro[6,7-dihydro-5H-cyclopenta[c]pyran-1,2'-oxolane] |
| SMILES | COc1cc(C)c(OC)c(C/C=C(\C)CC2=C[C@@]3(C)CCC[C@@]3(C)[C@]3(OC[C@H](OC)C3(C)C)O2)c1 |
| InChI | InChI=1S/C30H44O5/c1-20(11-12-22-17-23(31-7)16-21(2)26(22)33-9)15-24-18-28(5)13-10-14-29(28,6)30(35-24)27(3,4)25(32-8)19-34-30/h11,16-18,25H,10,12-15,19H2,1-9H3/b20-11+/t25-,28+,29+,30+/m0/s1 |
| InChIKey | KATLOAYNOCAERV-DGBDPOFPSA-N |
| XLogP | 6.77 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|