C17H20O4 — CID 102186934
(5R)-5-[(1R,2Z,4E)-1-(4-methoxyphenoxy)hexa-2,4-dienyl]oxolan-2-one (PubChem CID 102186934) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (5R)-5-[(1R,2Z,4E)-1-(4-methoxyphenoxy)hexa-2,4-dienyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1R,2Z,4E)-1-(4-methoxyphenoxy)hexa-2,4-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 102186934 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (5R)-5-[(1R,2Z,4E)-1-(4-methoxyphenoxy)hexa-2,4-dienyl]oxolan-2-one |
| SMILES | C/C=C/C=C\[C@@H](Oc1ccc(OC)cc1)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C17H20O4/c1-3-4-5-6-15(16-11-12-17(18)21-16)20-14-9-7-13(19-2)8-10-14/h3-10,15-16H,11-12H2,1-2H3/b4-3+,6-5-/t15-,16-/m1/s1 |
| InChIKey | FBCBZLPVCDTUQW-SVJGFXEFSA-N |
| XLogP | 3.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|