C18H20F4 — CID 102187103
1,2,3,4-tetraethyl-5,6,7,8-tetrafluoronaphthalene (PubChem CID 102187103) has the molecular formula C18H20F4 and a molecular weight of 312.35 g/mol. Its IUPAC name is 1,2,3,4-tetraethyl-5,6,7,8-tetrafluoronaphthalene.
| Compound Name | 1,2,3,4-tetraethyl-5,6,7,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 102187103 |
| Molecular Formula | C18H20F4 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1,2,3,4-tetraethyl-5,6,7,8-tetrafluoronaphthalene |
| SMILES | CCc1c(CC)c(CC)c2c(F)c(F)c(F)c(F)c2c1CC |
| InChI | InChI=1S/C18H20F4/c1-5-9-10(6-2)12(8-4)14-13(11(9)7-3)15(19)17(21)18(22)16(14)20/h5-8H2,1-4H3 |
| InChIKey | QUCCYQJYBDTWJK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|