C19H30O2 — CID 102187211
[(2R)-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]but-3-yn-2-yl] 2,2-dimethylpropanoate (PubChem CID 102187211) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [(2R)-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]but-3-yn-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]but-3-yn-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102187211 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [(2R)-1-[(3S,6R)-6-methyl-3-propan-2-ylcyclohexen-1-yl]but-3-yn-2-yl] 2,2-dimethylpropanoate |
| SMILES | C#C[C@@H](CC1=C[C@H](C(C)C)CC[C@H]1C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30O2/c1-8-17(21-18(20)19(5,6)7)12-16-11-15(13(2)3)10-9-14(16)4/h1,11,13-15,17H,9-10,12H2,2-7H3/t14-,15-,17+/m1/s1 |
| InChIKey | IKMCFHUUMFOESZ-INMHGKMJSA-N |
| XLogP | 4.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|