About 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan
4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan (PubChem CID 102187439) has the molecular formula C21H26O2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan.
Molecular Properties
| Compound Name | 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan |
| PubChem CID | 102187439 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan |
| SMILES | COc1ccc2ccc(C3=C(C(C)(C)C)C(C)(C)CO3)cc2c1 |
| InChI | InChI=1S/C21H26O2/c1-20(2,3)19-18(23-13-21(19,4)5)15-8-7-14-9-10-17(22-6)12-16(14)11-15/h7-12H,13H2,1-6H3 |
| InChIKey | SLTSUWQWXBMDQH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan?
The IUPAC name of 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan (CID 102187439) is 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan.
What is the SMILES notation for 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan?
The canonical SMILES for 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan is COc1ccc2ccc(C3=C(C(C)(C)C)C(C)(C)CO3)cc2c1.
What is the InChIKey of 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan?
The InChIKey is SLTSUWQWXBMDQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O2/c1-20(2,3)19-18(23-13-21(19,4)5)15-8-7-14-9-10-17(22-6)12-16(14)11-15/h7-12H,13H2,1-6H3.
What are the key properties of 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan?
4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan has a molecular weight of 310.44 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-5-(7-methoxynaphthalen-2-yl)-3,3-dimethyl-2H-furan is sourced from PubChem (CID 102187439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).