About 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane
2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane (PubChem CID 102187773) has the molecular formula C16H30O2S2
and a molecular weight of 318.55 g/mol. Its IUPAC name is 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane |
| PubChem CID | 102187773 |
| Molecular Formula | C16H30O2S2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane |
| SMILES | C(CCCCCC1SCCS1)CCCCC1OCCO1 |
| InChI | InChI=1S/C16H30O2S2/c1(3-5-7-9-15-17-11-12-18-15)2-4-6-8-10-16-19-13-14-20-16/h15-16H,1-14H2 |
| InChIKey | LDNXJRSCFNTQBC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane?
The IUPAC name of 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane (CID 102187773) is 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane.
What is the SMILES notation for 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane?
The canonical SMILES for 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane is C(CCCCCC1SCCS1)CCCCC1OCCO1.
What is the InChIKey of 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane?
The InChIKey is LDNXJRSCFNTQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2S2/c1(3-5-7-9-15-17-11-12-18-15)2-4-6-8-10-16-19-13-14-20-16/h15-16H,1-14H2.
What are the key properties of 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane?
2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane has a molecular weight of 318.55 g/mol, XLogP of 5.07, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[10-(1,3-dithiolan-2-yl)decyl]-1,3-dioxolane is sourced from PubChem (CID 102187773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).