C37H42ClF3N2O — CID 10218818
3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2-ethylbutyl)aniline (PubChem CID 10218818) has the molecular formula C37H42ClF3N2O and a molecular weight of 623.20 g/mol. Its IUPAC name is 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2-ethylbutyl)aniline.
| Compound Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2-ethylbutyl)aniline |
|---|---|
| PubChem CID | 10218818 |
| Molecular Formula | C37H42ClF3N2O |
| Molecular Weight | 623.20 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2-ethylbutyl)aniline |
| SMILES | CCC(CC)CNc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H42ClF3N2O/c1-3-28(4-2)25-42-32-19-12-20-33(24-32)44-23-13-22-43(26-31-18-11-21-35(36(31)38)37(39,40)41)27-34(29-14-7-5-8-15-29)30-16-9-6-10-17-30/h5-12,14-21,24,28,34,42H,3-4,13,22-23,25-27H2,1-2H3 |
| InChIKey | VDMCFZQIYBOMIX-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.20 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|