C18H25ClO4 — CID 102188509
(10E,12Z)-16-chloro-2-ethyl-15-hydroxy-3-oxabicyclo[12.3.0]heptadeca-10,12-diene-4,9-dione (PubChem CID 102188509) has the molecular formula C18H25ClO4 and a molecular weight of 340.85 g/mol. Its IUPAC name is (10E,12Z)-16-chloro-2-ethyl-15-hydroxy-3-oxabicyclo[12.3.0]heptadeca-10,12-diene-4,9-dione.
| Compound Name | (10E,12Z)-16-chloro-2-ethyl-15-hydroxy-3-oxabicyclo[12.3.0]heptadeca-10,12-diene-4,9-dione |
|---|---|
| PubChem CID | 102188509 |
| Molecular Formula | C18H25ClO4 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (10E,12Z)-16-chloro-2-ethyl-15-hydroxy-3-oxabicyclo[12.3.0]heptadeca-10,12-diene-4,9-dione |
| SMILES | CCC1OC(=O)CCCCC(=O)/C=C/C=C/C2C(O)C(Cl)CC12 |
| InChI | InChI=1S/C18H25ClO4/c1-2-16-14-11-15(19)18(22)13(14)9-5-3-7-12(20)8-4-6-10-17(21)23-16/h3,5,7,9,13-16,18,22H,2,4,6,8,10-11H2,1H3/b7-3+,9-5+ |
| InChIKey | ZWVVAYDRWLWBKX-DLYLGUBQSA-N |
| XLogP | 3.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|