C36H34N2O6 — CID 102188607
6,13-bis[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 102188607) has the molecular formula C36H34N2O6 and a molecular weight of 590.68 g/mol. Its IUPAC name is 6,13-bis[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 102188607 |
| Molecular Formula | C36H34N2O6 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 6,13-bis[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCC(C)(C)c1ccc(O)c(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2cc(C(C)(C)CC)ccc2O)C4=O)c1 |
| InChI | InChI=1S/C36H34N2O6/c1-7-35(3,4)19-9-15-27(39)25(17-19)37-31(41)21-11-13-23-30-24(14-12-22(29(21)30)32(37)42)34(44)38(33(23)43)26-18-20(10-16-28(26)40)36(5,6)8-2/h9-18,39-40H,7-8H2,1-6H3 |
| InChIKey | ZYGAFQQRDFNGSV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|