C36H42N4O7 — CID 10218861
ethyl 2-[benzyl-[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]acetate (PubChem CID 10218861) has the molecular formula C36H42N4O7 and a molecular weight of 642.75 g/mol. Its IUPAC name is ethyl 2-[benzyl-[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 10218861 |
| Molecular Formula | C36H42N4O7 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | ethyl 2-[benzyl-[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)c1nc(OC)c(NC(=O)c2ccc(Cc3cc4c(cc3C)C(C)(C)OC4(C)C)o2)c(OC)n1 |
| InChI | InChI=1S/C36H42N4O7/c1-9-45-29(41)21-40(20-23-13-11-10-12-14-23)34-38-32(43-7)30(33(39-34)44-8)37-31(42)28-16-15-25(46-28)18-24-19-27-26(17-22(24)2)35(3,4)47-36(27,5)6/h10-17,19H,9,18,20-21H2,1-8H3,(H,37,42) |
| InChIKey | VKYGSMKQMXHHRL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |