C11H10Cl3NO2 — CID 102188919
2,2,2-trichloro-N-(2-methyl-3H-1-benzofuran-2-yl)acetamide (PubChem CID 102188919) has the molecular formula C11H10Cl3NO2 and a molecular weight of 294.57 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-methyl-3H-1-benzofuran-2-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-methyl-3H-1-benzofuran-2-yl)acetamide |
|---|---|
| PubChem CID | 102188919 |
| Molecular Formula | C11H10Cl3NO2 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 2,2,2-trichloro-N-(2-methyl-3H-1-benzofuran-2-yl)acetamide |
| SMILES | CC1(NC(=O)C(Cl)(Cl)Cl)Cc2ccccc2O1 |
| InChI | InChI=1S/C11H10Cl3NO2/c1-10(15-9(16)11(12,13)14)6-7-4-2-3-5-8(7)17-10/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | MRLYFVGCRUTGDV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|