C7H11N3O4 — CID 102188932
(4S,5R,6S,7S)-7-methoxy-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-4,5,6-triol (PubChem CID 102188932) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is (4S,5R,6S,7S)-7-methoxy-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-4,5,6-triol.
| Compound Name | (4S,5R,6S,7S)-7-methoxy-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-4,5,6-triol |
|---|---|
| PubChem CID | 102188932 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (4S,5R,6S,7S)-7-methoxy-4,5,6,7-tetrahydrotriazolo[1,5-a]pyridine-4,5,6-triol |
| SMILES | CO[C@H]1[C@@H](O)[C@H](O)[C@@H](O)c2cnnn21 |
| InChI | InChI=1S/C7H11N3O4/c1-14-7-6(13)5(12)4(11)3-2-8-9-10(3)7/h2,4-7,11-13H,1H3/t4-,5+,6-,7-/m0/s1 |
| InChIKey | XYSZAEZBAWKATF-VZFHVOOUSA-N |
| XLogP | -1.81 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |