C23H32O3 — CID 102189214
(1'R,9'S,10'S,13'R)-2,2,9'-trimethyl-14'-methylidenespiro[1,3-dioxane-5,5'-tetracyclo[11.2.1.01,10.04,9]hexadec-3-ene]-2'-one (PubChem CID 102189214) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (1'R,9'S,10'S,13'R)-2,2,9'-trimethyl-14'-methylidenespiro[1,3-dioxane-5,5'-tetracyclo[11.2.1.01,10.04,9]hexadec-3-ene]-2'-one.
| Compound Name | (1'R,9'S,10'S,13'R)-2,2,9'-trimethyl-14'-methylidenespiro[1,3-dioxane-5,5'-tetracyclo[11.2.1.01,10.04,9]hexadec-3-ene]-2'-one |
|---|---|
| PubChem CID | 102189214 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (1'R,9'S,10'S,13'R)-2,2,9'-trimethyl-14'-methylidenespiro[1,3-dioxane-5,5'-tetracyclo[11.2.1.01,10.04,9]hexadec-3-ene]-2'-one |
| SMILES | C=C1C[C@]23C[C@H]1CC[C@H]2[C@]1(C)CCCC2(COC(C)(C)OC2)C1=CC3=O |
| InChI | InChI=1S/C23H32O3/c1-15-11-23-12-16(15)6-7-17(23)21(4)8-5-9-22(18(21)10-19(23)24)13-25-20(2,3)26-14-22/h10,16-17H,1,5-9,11-14H2,2-4H3/t16-,17+,21+,23+/m1/s1 |
| InChIKey | GWWHUNVMSIQVJW-ISFWSWAHSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|