C25H40 — CID 102190386
(1R,4E,9S,11R)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene (PubChem CID 102190386) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (1R,4E,9S,11R)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene.
| Compound Name | (1R,4E,9S,11R)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
|---|---|
| PubChem CID | 102190386 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (1R,4E,9S,11R)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| SMILES | C=C1CC/C=C(\C)CC[C@@H]2[C@@H]1C[C@@]2(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H40/c1-19(2)10-7-11-20(3)13-9-17-25(6)18-23-22(5)14-8-12-21(4)15-16-24(23)25/h10,12-13,23-24H,5,7-9,11,14-18H2,1-4,6H3/b20-13+,21-12+/t23-,24-,25-/m1/s1 |
| InChIKey | KEWHXPJNBRKPIV-YCRSHSPUSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|