C14H14Cl3N3O4 — CID 102191238
ethyl (3S)-2-diazo-3-(3-methoxyphenyl)-3-[(2,2,2-trichloroacetyl)amino]propanoate (PubChem CID 102191238) has the molecular formula C14H14Cl3N3O4 and a molecular weight of 394.64 g/mol. Its IUPAC name is ethyl (3S)-2-diazo-3-(3-methoxyphenyl)-3-[(2,2,2-trichloroacetyl)amino]propanoate.
| Compound Name | ethyl (3S)-2-diazo-3-(3-methoxyphenyl)-3-[(2,2,2-trichloroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 102191238 |
| Molecular Formula | C14H14Cl3N3O4 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | ethyl (3S)-2-diazo-3-(3-methoxyphenyl)-3-[(2,2,2-trichloroacetyl)amino]propanoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])[C@@H](NC(=O)C(Cl)(Cl)Cl)c1cccc(OC)c1 |
| InChI | InChI=1S/C14H14Cl3N3O4/c1-3-24-12(21)11(20-18)10(19-13(22)14(15,16)17)8-5-4-6-9(7-8)23-2/h4-7,10H,3H2,1-2H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | NWQBAXAMDGGWHL-JTQLQIEISA-N |
| XLogP | 2.46 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|