C11H11F7N2O2 — CID 102191289
ethyl 2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl]acetate (PubChem CID 102191289) has the molecular formula C11H11F7N2O2 and a molecular weight of 336.21 g/mol. Its IUPAC name is ethyl 2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl]acetate.
| Compound Name | ethyl 2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 102191289 |
| Molecular Formula | C11H11F7N2O2 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | ethyl 2-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methylpyrazol-5-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)(F)C(F)(F)C(F)(F)F)nn1C |
| InChI | InChI=1S/C11H11F7N2O2/c1-3-22-8(21)5-6-4-7(19-20(6)2)9(12,13)10(14,15)11(16,17)18/h4H,3,5H2,1-2H3 |
| InChIKey | CCCFGOLUOHAGOK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|