C20H26BNO3 — CID 102191490
2-methoxy-3-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine (PubChem CID 102191490) has the molecular formula C20H26BNO3 and a molecular weight of 339.24 g/mol. Its IUPAC name is 2-methoxy-3-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine.
| Compound Name | 2-methoxy-3-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 102191490 |
| Molecular Formula | C20H26BNO3 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-methoxy-3-[(1R)-1-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine |
| SMILES | COc1ncccc1[C@@](C)(B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C20H26BNO3/c1-18(2)19(3,4)25-21(24-18)20(5,15-11-8-7-9-12-15)16-13-10-14-22-17(16)23-6/h7-14H,1-6H3/t20-/m0/s1 |
| InChIKey | GAQYNBPUJMCBTO-FQEVSTJZSA-N |
| XLogP | 4.03 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|