About 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene
2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene (PubChem CID 102192018) has the molecular formula C12H8BrF7O4S2
and a molecular weight of 493.22 g/mol. Its IUPAC name is 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene.
Molecular Properties
| Compound Name | 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene |
| PubChem CID | 102192018 |
| Molecular Formula | C12H8BrF7O4S2 |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 491.89 |
| IUPAC Name | 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene |
| SMILES | O=S(=O)(C(C/C=C/c1cc(F)ccc1Br)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8BrF7O4S2/c13-9-5-4-8(14)6-7(9)2-1-3-10(25(21,22)11(15,16)17)26(23,24)12(18,19)20/h1-2,4-6,10H,3H2/b2-1+ |
| InChIKey | WHYMSMSLDINYBR-OWOJBTEDSA-N |
| XLogP | 4.19 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene?
The IUPAC name of 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene (CID 102192018) is 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene.
What is the SMILES notation for 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene?
The canonical SMILES for 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene is O=S(=O)(C(C/C=C/c1cc(F)ccc1Br)S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene?
The InChIKey is WHYMSMSLDINYBR-OWOJBTEDSA-N. The full InChI is InChI=1S/C12H8BrF7O4S2/c13-9-5-4-8(14)6-7(9)2-1-3-10(25(21,22)11(15,16)17)26(23,24)12(18,19)20/h1-2,4-6,10H,3H2/b2-1+.
What are the key properties of 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene?
2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene has a molecular weight of 493.22 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-4,4-bis(trifluoromethylsulfonyl)but-1-enyl]-1-bromo-4-fluorobenzene is sourced from PubChem (CID 102192018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).